About ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate
ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate (PubChem CID 173466196) has the molecular formula C24H26N2O10
and a molecular weight of 502.48 g/mol. Its IUPAC name is ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate |
| PubChem CID | 173466196 |
| Molecular Formula | C24H26N2O10 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)Nc1ccc(OOC(=O)C=C)cc1.CCOC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C15H15NO7.C9H11NO3/c1-3-13(17)20-9-10-21-15(19)16-11-5-7-12(8-6-11)22-23-14(18)4-2;1-2-13-9(12)10-7-3-5-8(11)6-4-7/h3-8H,1-2,9-10H2,(H,16,19);3-6,11H,2H2,1H3,(H,10,12) |
| InChIKey | DRESMIGMYFYTAM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate?
The IUPAC name of ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate (CID 173466196) is ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate.
What is the SMILES notation for ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate?
The canonical SMILES for ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate is C=CC(=O)OCCOC(=O)Nc1ccc(OOC(=O)C=C)cc1.CCOC(=O)Nc1ccc(O)cc1.
What is the InChIKey of ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate?
The InChIKey is DRESMIGMYFYTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO7.C9H11NO3/c1-3-13(17)20-9-10-21-15(19)16-11-5-7-12(8-6-11)22-23-14(18)4-2;1-2-13-9(12)10-7-3-5-8(11)6-4-7/h3-8H,1-2,9-10H2,(H,16,19);3-6,11H,2H2,1H3,(H,10,12).
What are the key properties of ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate?
ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate has a molecular weight of 502.48 g/mol, XLogP of 3.95, 10 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(4-hydroxyphenyl)carbamate;2-[(4-prop-2-enoylperoxyphenyl)carbamoyloxy]ethyl prop-2-enoate is sourced from PubChem (CID 173466196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).