C36H32F12O2 — CID 173466575
2,8-bis[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,4a,4b,5,5a,5b,6,7,8,9,9a,10a,11,11a,12a-octadecahydroindeno[2,1-b]fluorene-10,12-dione (PubChem CID 173466575) has the molecular formula C36H32F12O2 and a molecular weight of 724.63 g/mol. Its IUPAC name is 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,4a,4b,5,5a,5b,6,7,8,9,9a,10a,11,11a,12a-octadecahydroindeno[2,1-b]fluorene-10,12-dione.
| Compound Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,4a,4b,5,5a,5b,6,7,8,9,9a,10a,11,11a,12a-octadecahydroindeno[2,1-b]fluorene-10,12-dione |
|---|---|
| PubChem CID | 173466575 |
| Molecular Formula | C36H32F12O2 |
| Molecular Weight | 724.63 g/mol |
| Exact Mass | 724.22 |
| IUPAC Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-1,2,3,4,4a,4b,5,5a,5b,6,7,8,9,9a,10a,11,11a,12a-octadecahydroindeno[2,1-b]fluorene-10,12-dione |
| SMILES | O=C1C2CC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC2C2CC3C(CC12)C(=O)C1CC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC13 |
| InChI | InChI=1S/C36H32F12O2/c37-33(38,39)19-5-17(6-20(11-19)34(40,41)42)15-1-3-23-25-13-26-24-4-2-16(18-7-21(35(43,44)45)12-22(8-18)36(46,47)48)10-28(24)32(50)30(26)14-29(25)31(49)27(23)9-15/h5-8,11-12,15-16,23-30H,1-4,9-10,13-14H2 |
| InChIKey | ZRGRGSZBOXBTAE-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.63 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |