C18H22FN5O — CID 173466642
N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-[1-[(Z)-prop-1-enoxy]ethenylamino]penta-1,3-dien-3-yl]ethanimidamide (PubChem CID 173466642) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-[1-[(Z)-prop-1-enoxy]ethenylamino]penta-1,3-dien-3-yl]ethanimidamide.
| Compound Name | N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-[1-[(Z)-prop-1-enoxy]ethenylamino]penta-1,3-dien-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 173466642 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-[1-[(Z)-prop-1-enoxy]ethenylamino]penta-1,3-dien-3-yl]ethanimidamide |
| SMILES | [H]/N=C/C=C(\N=C(/C)N)C(NC(=C)O/C=C\C)=C(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN5O/c1-4-11-25-13(3)24-18(16(9-10-20)23-12(2)21)17(22)14-5-7-15(19)8-6-14/h4-11,20,24H,3,22H2,1-2H3,(H2,21,23)/b11-4-,16-9-,18-17?,20-10+ |
| InChIKey | RKSCKTFALZZOEX-IQWWUENASA-N |
| XLogP | 2.97 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|