C17H18FN5O — CID 173466650
N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-(2-methylidene-1,3-oxazol-3-yl)penta-1,3-dien-3-yl]ethanimidamide (PubChem CID 173466650) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-(2-methylidene-1,3-oxazol-3-yl)penta-1,3-dien-3-yl]ethanimidamide.
| Compound Name | N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-(2-methylidene-1,3-oxazol-3-yl)penta-1,3-dien-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 173466650 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N'-[(3Z)-1-amino-1-(4-fluorophenyl)-5-imino-2-(2-methylidene-1,3-oxazol-3-yl)penta-1,3-dien-3-yl]ethanimidamide |
| SMILES | [H]/N=C/C=C(\N=C(/C)N)C(=C(N)c1ccc(F)cc1)N1C=COC1=C |
| InChI | InChI=1S/C17H18FN5O/c1-11(20)22-15(7-8-19)17(23-9-10-24-12(23)2)16(21)13-3-5-14(18)6-4-13/h3-10,19H,2,21H2,1H3,(H2,20,22)/b15-7-,17-16?,19-8+ |
| InChIKey | ZBSHZUZQZJMNQS-UTUMMWALSA-N |
| XLogP | 2.64 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|