C29H24O2 — CID 173466717
2-[2-oxo-2-[(5E)-7-phenylcycloocta-1,5,7-trien-1-yl]ethyl]-4-phenylbenzaldehyde (PubChem CID 173466717) has the molecular formula C29H24O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[2-oxo-2-[(5E)-7-phenylcycloocta-1,5,7-trien-1-yl]ethyl]-4-phenylbenzaldehyde.
| Compound Name | 2-[2-oxo-2-[(5E)-7-phenylcycloocta-1,5,7-trien-1-yl]ethyl]-4-phenylbenzaldehyde |
|---|---|
| PubChem CID | 173466717 |
| Molecular Formula | C29H24O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[2-oxo-2-[(5E)-7-phenylcycloocta-1,5,7-trien-1-yl]ethyl]-4-phenylbenzaldehyde |
| SMILES | O=Cc1ccc(-c2ccccc2)cc1CC(=O)C1=CCC/C=C\C(c2ccccc2)=C1 |
| InChI | InChI=1S/C29H24O2/c30-21-27-17-16-25(23-12-6-2-7-13-23)19-28(27)20-29(31)26-15-9-3-8-14-24(18-26)22-10-4-1-5-11-22/h1-2,4-8,10-19,21H,3,9,20H2/b14-8-,24-18?,26-15? |
| InChIKey | SPHBAAACZOLBHP-CTGYTHQLSA-N |
| XLogP | 6.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|