C18H25N3O5 — CID 173467142
(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 3-[(E)-3-(methoxyamino)-2-methylprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 173467142) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 3-[(E)-3-(methoxyamino)-2-methylprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 3-[(E)-3-(methoxyamino)-2-methylprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 173467142 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 3-[(E)-3-(methoxyamino)-2-methylprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C#CCN1CC(=O)N(COC(=O)C2C(/C=C(\C)CNOC)C2(C)C)C1=O |
| InChI | InChI=1S/C18H25N3O5/c1-6-7-20-10-14(22)21(17(20)24)11-26-16(23)15-13(18(15,3)4)8-12(2)9-19-25-5/h1,8,13,15,19H,7,9-11H2,2-5H3/b12-8+ |
| InChIKey | LLJIMKZTCRXBEZ-XYOKQWHBSA-N |
| XLogP | 0.75 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|