C22H22ClFN4O4 — CID 173467900
(2E)-2-[2-[(3Z)-4-(aminomethylideneamino)-4-(3-chloro-2-methylphenoxy)-3-fluorobuta-1,3-dien-2-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 173467900) has the molecular formula C22H22ClFN4O4 and a molecular weight of 460.89 g/mol. Its IUPAC name is (2E)-2-[2-[(3Z)-4-(aminomethylideneamino)-4-(3-chloro-2-methylphenoxy)-3-fluorobuta-1,3-dien-2-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[(3Z)-4-(aminomethylideneamino)-4-(3-chloro-2-methylphenoxy)-3-fluorobuta-1,3-dien-2-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 173467900 |
| Molecular Formula | C22H22ClFN4O4 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (2E)-2-[2-[(3Z)-4-(aminomethylideneamino)-4-(3-chloro-2-methylphenoxy)-3-fluorobuta-1,3-dien-2-yl]oxyphenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | C=C(Oc1ccccc1/C(=N\OC)C(=O)NC)/C(F)=C(\N=CN)Oc1cccc(Cl)c1C |
| InChI | InChI=1S/C22H22ClFN4O4/c1-13-16(23)9-7-11-17(13)32-22(27-12-25)19(24)14(2)31-18-10-6-5-8-15(18)20(28-30-4)21(29)26-3/h5-12H,2H2,1,3-4H3,(H2,25,27)(H,26,29)/b22-19-,28-20+ |
| InChIKey | UBRDDLACYKGCEU-DHKAZJEUSA-N |
| XLogP | 3.84 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|