C11H13I — CID 173467961
(3Z,5E)-3,8-dimethyl-1λ3-iodacyclodeca-1,3,5,7,9-pentaene (PubChem CID 173467961) has the molecular formula C11H13I and a molecular weight of 272.13 g/mol. Its IUPAC name is (3Z,5E)-3,8-dimethyl-1λ3-iodacyclodeca-1,3,5,7,9-pentaene.
| Compound Name | (3Z,5E)-3,8-dimethyl-1λ3-iodacyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 173467961 |
| Molecular Formula | C11H13I |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | (3Z,5E)-3,8-dimethyl-1λ3-iodacyclodeca-1,3,5,7,9-pentaene |
| SMILES | CC1=C/C=C/C=C(C)\C=I\C=C1 |
| InChI | InChI=1S/C11H13I/c1-10-5-3-4-6-11(2)9-12-8-7-10/h3-9H,1-2H3/b4-3+,5-3?,6-4-,8-7?,10-5?,10-7?,11-6-,11-9- |
| InChIKey | ONKGXHUUISTMDO-WTPBPGCQSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|