About potassium;hydride;5-nitro-1,2,4-triazol-3-one
potassium;hydride;5-nitro-1,2,4-triazol-3-one (PubChem CID 173468136) has the molecular formula C2HKN4O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is potassium;hydride;5-nitro-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | potassium;hydride;5-nitro-1,2,4-triazol-3-one |
| PubChem CID | 173468136 |
| Molecular Formula | C2HKN4O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 167.97 |
| IUPAC Name | potassium;hydride;5-nitro-1,2,4-triazol-3-one |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.[H-].[K+] |
| InChI | InChI=1S/C2N4O3.K.H/c7-2-3-1(4-5-2)6(8)9;;/q;+1;-1 |
| InChIKey | GPVALIPKVNKMJG-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 97.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;5-nitro-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;5-nitro-1,2,4-triazol-3-one?
The IUPAC name of potassium;hydride;5-nitro-1,2,4-triazol-3-one (CID 173468136) is potassium;hydride;5-nitro-1,2,4-triazol-3-one.
What is the SMILES notation for potassium;hydride;5-nitro-1,2,4-triazol-3-one?
The canonical SMILES for potassium;hydride;5-nitro-1,2,4-triazol-3-one is O=C1N=NC([N+](=O)[O-])=N1.[H-].[K+].
What is the InChIKey of potassium;hydride;5-nitro-1,2,4-triazol-3-one?
The InChIKey is GPVALIPKVNKMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3.K.H/c7-2-3-1(4-5-2)6(8)9;;/q;+1;-1.
What are the key properties of potassium;hydride;5-nitro-1,2,4-triazol-3-one?
potassium;hydride;5-nitro-1,2,4-triazol-3-one has a molecular weight of 168.15 g/mol, XLogP of -2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;5-nitro-1,2,4-triazol-3-one is sourced from PubChem (CID 173468136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).