C20H26O2 — CID 173469605
(2,6,6-trimethylcyclohexen-1-yl) undeca-2,4,6,8,10-pentaenoate (PubChem CID 173469605) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2,6,6-trimethylcyclohexen-1-yl) undeca-2,4,6,8,10-pentaenoate.
| Compound Name | (2,6,6-trimethylcyclohexen-1-yl) undeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 173469605 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2,6,6-trimethylcyclohexen-1-yl) undeca-2,4,6,8,10-pentaenoate |
| SMILES | C=CC=CC=CC=CC=CC(=O)OC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H26O2/c1-5-6-7-8-9-10-11-12-15-18(21)22-19-17(2)14-13-16-20(19,3)4/h5-12,15H,1,13-14,16H2,2-4H3 |
| InChIKey | TWVCNOFITXDPTI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|