C15H30OSi — CID 173469652
[(1E,6E)-5-tert-butyl-6-methylocta-1,6-dienoxy]-dimethylsilane (PubChem CID 173469652) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is [(1E,6E)-5-tert-butyl-6-methylocta-1,6-dienoxy]-dimethylsilane.
| Compound Name | [(1E,6E)-5-tert-butyl-6-methylocta-1,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 173469652 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | [(1E,6E)-5-tert-butyl-6-methylocta-1,6-dienoxy]-dimethylsilane |
| SMILES | C/C=C(\C)C(CC/C=C/O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-8-13(2)14(15(3,4)5)11-9-10-12-16-17(6)7/h8,10,12,14,17H,9,11H2,1-7H3/b12-10+,13-8+ |
| InChIKey | WPNHDJPDLIQDIZ-PJCPOQCISA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|