methyl 2,3-dimethyl-2-silylpentanoate

C8H18O2Si — CID 173470080

IUPACmethyl 2,3-dimethyl-2-silylpentanoate
SMILESCCC(C)C(C)([SiH3])C(=O)OC
InChIInChI=1S/C8H18O2Si/c1-5-6(2)8(3,11)7(9)10-4/h6H,5H2,1-4,11H3
InChIKeyYBKASKZTSSBLEB-UHFFFAOYSA-N
MW174.32 g/mol
LogP0.75
Rot. Bonds3

About methyl 2,3-dimethyl-2-silylpentanoate

methyl 2,3-dimethyl-2-silylpentanoate (PubChem CID 173470080) has the molecular formula C8H18O2Si and a molecular weight of 174.32 g/mol. Its IUPAC name is methyl 2,3-dimethyl-2-silylpentanoate.

Molecular Properties

Compound Namemethyl 2,3-dimethyl-2-silylpentanoate
PubChem CID173470080
Molecular FormulaC8H18O2Si
Molecular Weight174.32 g/mol
Exact Mass174.11
IUPAC Namemethyl 2,3-dimethyl-2-silylpentanoate
SMILESCCC(C)C(C)([SiH3])C(=O)OC
InChIInChI=1S/C8H18O2Si/c1-5-6(2)8(3,11)7(9)10-4/h6H,5H2,1-4,11H3
InChIKeyYBKASKZTSSBLEB-UHFFFAOYSA-N
XLogP0.75
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.32
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl 2,3-dimethyl-2-silylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-dimethyl-2-silylpentanoate?
The IUPAC name of methyl 2,3-dimethyl-2-silylpentanoate (CID 173470080) is methyl 2,3-dimethyl-2-silylpentanoate.
What is the SMILES notation for methyl 2,3-dimethyl-2-silylpentanoate?
The canonical SMILES for methyl 2,3-dimethyl-2-silylpentanoate is CCC(C)C(C)([SiH3])C(=O)OC.
What is the InChIKey of methyl 2,3-dimethyl-2-silylpentanoate?
The InChIKey is YBKASKZTSSBLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2Si/c1-5-6(2)8(3,11)7(9)10-4/h6H,5H2,1-4,11H3.
What are the key properties of methyl 2,3-dimethyl-2-silylpentanoate?
methyl 2,3-dimethyl-2-silylpentanoate has a molecular weight of 174.32 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dimethyl-2-silylpentanoate is sourced from PubChem (CID 173470080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).