C7H3F5O4 — CID 173470424
4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)cyclopentane-1,2,3-trione (PubChem CID 173470424) has the molecular formula C7H3F5O4 and a molecular weight of 246.09 g/mol. Its IUPAC name is 4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)cyclopentane-1,2,3-trione.
| Compound Name | 4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)cyclopentane-1,2,3-trione |
|---|---|
| PubChem CID | 173470424 |
| Molecular Formula | C7H3F5O4 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)cyclopentane-1,2,3-trione |
| SMILES | O=C1C(=O)C(O)C(C(F)(F)C(F)(F)F)C1=O |
| InChI | InChI=1S/C7H3F5O4/c8-6(9,7(10,11)12)1-2(13)4(15)5(16)3(1)14/h1-2,13H |
| InChIKey | LRWDKNFLMULTCQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|