C22H30N6 — CID 173470440
6-[3-[(1E,3Z)-4-amino-3-hydrazinylpenta-1,3-dienyl]phenyl]-N-(piperidin-4-ylmethyl)pyridin-2-amine (PubChem CID 173470440) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 6-[3-[(1E,3Z)-4-amino-3-hydrazinylpenta-1,3-dienyl]phenyl]-N-(piperidin-4-ylmethyl)pyridin-2-amine.
| Compound Name | 6-[3-[(1E,3Z)-4-amino-3-hydrazinylpenta-1,3-dienyl]phenyl]-N-(piperidin-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 173470440 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 6-[3-[(1E,3Z)-4-amino-3-hydrazinylpenta-1,3-dienyl]phenyl]-N-(piperidin-4-ylmethyl)pyridin-2-amine |
| SMILES | C/C(N)=C(\C=C\c1cccc(-c2cccc(NCC3CCNCC3)n2)c1)NN |
| InChI | InChI=1S/C22H30N6/c1-16(23)20(28-24)9-8-17-4-2-5-19(14-17)21-6-3-7-22(27-21)26-15-18-10-12-25-13-11-18/h2-9,14,18,25,28H,10-13,15,23-24H2,1H3,(H,26,27)/b9-8+,20-16- |
| InChIKey | WVIZAHYYDZRFMQ-ACCAXWRPSA-N |
| XLogP | 2.83 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|