C34H32N3O6+ — CID 173470623
3-[2-[5-[3-(2-carboxyethyl)benzo[f][1,3]benzoxazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-3a,7,8,9,9a,9b-hexahydrobenzo[g][1,3]benzoxazol-3-yl]propanoic acid (PubChem CID 173470623) has the molecular formula C34H32N3O6+ and a molecular weight of 578.65 g/mol. Its IUPAC name is 3-[2-[5-[3-(2-carboxyethyl)benzo[f][1,3]benzoxazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-3a,7,8,9,9a,9b-hexahydrobenzo[g][1,3]benzoxazol-3-yl]propanoic acid.
| Compound Name | 3-[2-[5-[3-(2-carboxyethyl)benzo[f][1,3]benzoxazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-3a,7,8,9,9a,9b-hexahydrobenzo[g][1,3]benzoxazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 173470623 |
| Molecular Formula | C34H32N3O6+ |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[2-[5-[3-(2-carboxyethyl)benzo[f][1,3]benzoxazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-3a,7,8,9,9a,9b-hexahydrobenzo[g][1,3]benzoxazol-3-yl]propanoic acid |
| SMILES | N#CC(C=Cc1oc2cc3ccccc3cc2[n+]1CCC(=O)O)=CC=C1OC2C3CCCC=C3C=CC2N1CCC(=O)O |
| InChI | InChI=1S/C34H31N3O6/c35-21-22(9-13-30-37(18-16-33(40)41)28-19-24-6-1-2-7-25(24)20-29(28)42-30)10-14-31-36(17-15-32(38)39)27-12-11-23-5-3-4-8-26(23)34(27)43-31/h1-2,5-7,9-14,19-20,26-27,34H,3-4,8,15-18H2,(H-,38,39,40,41)/p+1 |
| InChIKey | MJHXXLRTPKBAGJ-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|