C6H6F12Si2 — CID 173470739
(1,2,2,3,3,4,4,5,5,6,6,6-dodecafluoro-1-silylhexyl)silane (PubChem CID 173470739) has the molecular formula C6H6F12Si2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5,5,6,6,6-dodecafluoro-1-silylhexyl)silane.
| Compound Name | (1,2,2,3,3,4,4,5,5,6,6,6-dodecafluoro-1-silylhexyl)silane |
|---|---|
| PubChem CID | 173470739 |
| Molecular Formula | C6H6F12Si2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6,6-dodecafluoro-1-silylhexyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)([SiH3])[SiH3] |
| InChI | InChI=1S/C6H6F12Si2/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20/h19-20H3 |
| InChIKey | YUGBXFMOYGTWIQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|