C15H23F2NO2 — CID 173470869
N-[(4E,6E)-6-(1,1-difluoroethoxymethyl)-2-methylidenenona-4,6-dienyl]acetamide (PubChem CID 173470869) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[(4E,6E)-6-(1,1-difluoroethoxymethyl)-2-methylidenenona-4,6-dienyl]acetamide.
| Compound Name | N-[(4E,6E)-6-(1,1-difluoroethoxymethyl)-2-methylidenenona-4,6-dienyl]acetamide |
|---|---|
| PubChem CID | 173470869 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(4E,6E)-6-(1,1-difluoroethoxymethyl)-2-methylidenenona-4,6-dienyl]acetamide |
| SMILES | C=C(C/C=C/C(=C\CC)COC(C)(F)F)CNC(C)=O |
| InChI | InChI=1S/C15H23F2NO2/c1-5-7-14(11-20-15(4,16)17)9-6-8-12(2)10-18-13(3)19/h6-7,9H,2,5,8,10-11H2,1,3-4H3,(H,18,19)/b9-6+,14-7+ |
| InChIKey | QBPMYTVODQOXEH-GTXFBGKMSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|