C45H55N3O8S — CID 173471064
tert-butyl 3-[(6S,9R,13R)-17-hydroxy-5,8,11,15-tetraoxo-13-[(E)-pent-1-enyl]-6-(tritylsulfanylmethyl)-14-oxa-4,7,10-triazaspiro[2.14]heptadecan-9-yl]propanoate (PubChem CID 173471064) has the molecular formula C45H55N3O8S and a molecular weight of 798.02 g/mol. Its IUPAC name is tert-butyl 3-[(6S,9R,13R)-17-hydroxy-5,8,11,15-tetraoxo-13-[(E)-pent-1-enyl]-6-(tritylsulfanylmethyl)-14-oxa-4,7,10-triazaspiro[2.14]heptadecan-9-yl]propanoate.
| Compound Name | tert-butyl 3-[(6S,9R,13R)-17-hydroxy-5,8,11,15-tetraoxo-13-[(E)-pent-1-enyl]-6-(tritylsulfanylmethyl)-14-oxa-4,7,10-triazaspiro[2.14]heptadecan-9-yl]propanoate |
|---|---|
| PubChem CID | 173471064 |
| Molecular Formula | C45H55N3O8S |
| Molecular Weight | 798.02 g/mol |
| Exact Mass | 797.37 |
| IUPAC Name | tert-butyl 3-[(6S,9R,13R)-17-hydroxy-5,8,11,15-tetraoxo-13-[(E)-pent-1-enyl]-6-(tritylsulfanylmethyl)-14-oxa-4,7,10-triazaspiro[2.14]heptadecan-9-yl]propanoate |
| SMILES | CCC/C=C/[C@H]1CC(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)N[C@H](CSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)NC2(CC2)C(O)CC(=O)O1 |
| InChI | InChI=1S/C45H55N3O8S/c1-5-6-10-23-34-28-38(50)46-35(24-25-39(51)56-43(2,3)4)41(53)47-36(42(54)48-44(26-27-44)37(49)29-40(52)55-34)30-57-45(31-17-11-7-12-18-31,32-19-13-8-14-20-32)33-21-15-9-16-22-33/h7-23,34-37,49H,5-6,24-30H2,1-4H3,(H,46,50)(H,47,53)(H,48,54)/b23-10+/t34-,35+,36+,37?/m0/s1 |
| InChIKey | MHVXBHPSDQLCTH-UTOKSPKMSA-N |
| XLogP | 5.87 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|