C10H15FN2O — CID 173471536
1-[(4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]-3-methylurea (PubChem CID 173471536) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-[(4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]-3-methylurea.
| Compound Name | 1-[(4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]-3-methylurea |
|---|---|
| PubChem CID | 173471536 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-[(4Z,6E)-6-fluoroocta-2,4,6-trien-3-yl]-3-methylurea |
| SMILES | CC=C(/C=C\C(F)=C/C)NC(=O)NC |
| InChI | InChI=1S/C10H15FN2O/c1-4-8(11)6-7-9(5-2)13-10(14)12-3/h4-7H,1-3H3,(H2,12,13,14)/b7-6-,8-4+,9-5? |
| InChIKey | BJBYCLMOZXJEGE-BAWWUTGUSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|