C27H28FN5O5 — CID 173471718
2-[4-[[(E)-2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-enoyl]amino]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 173471718) has the molecular formula C27H28FN5O5 and a molecular weight of 521.55 g/mol. Its IUPAC name is 2-[4-[[(E)-2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-enoyl]amino]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[(E)-2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-enoyl]amino]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 173471718 |
| Molecular Formula | C27H28FN5O5 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 2-[4-[[(E)-2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-enoyl]amino]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | COc1ccc(/C(=C\c2ccc(F)cc2)C(=O)NC2CCN(c3ncc(C(=O)NO)cn3)CC2)cc1OC |
| InChI | InChI=1S/C27H28FN5O5/c1-37-23-8-5-18(14-24(23)38-2)22(13-17-3-6-20(28)7-4-17)26(35)31-21-9-11-33(12-10-21)27-29-15-19(16-30-27)25(34)32-36/h3-8,13-16,21,36H,9-12H2,1-2H3,(H,31,35)(H,32,34)/b22-13+ |
| InChIKey | ACILYFAFDDONEU-LPYMAVHISA-N |
| XLogP | 3.08 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|