C28H25N5O — CID 173471854
(1E,3Z,5E,8S)-8-[5-(5-methyl-1,3-diphenylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]bicyclo[5.2.1]deca-1,3,5-trien-8-amine (PubChem CID 173471854) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is (1E,3Z,5E,8S)-8-[5-(5-methyl-1,3-diphenylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]bicyclo[5.2.1]deca-1,3,5-trien-8-amine.
| Compound Name | (1E,3Z,5E,8S)-8-[5-(5-methyl-1,3-diphenylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]bicyclo[5.2.1]deca-1,3,5-trien-8-amine |
|---|---|
| PubChem CID | 173471854 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (1E,3Z,5E,8S)-8-[5-(5-methyl-1,3-diphenylpyrazol-4-yl)-1,3,4-oxadiazol-2-yl]bicyclo[5.2.1]deca-1,3,5-trien-8-amine |
| SMILES | Cc1c(-c2nnc([C@]3(N)C/C4=C/C=C\C=C/C3C4)o2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C28H25N5O/c1-19-24(25(21-12-6-3-7-13-21)32-33(19)23-15-9-4-10-16-23)26-30-31-27(34-26)28(29)18-20-11-5-2-8-14-22(28)17-20/h2-16,22H,17-18,29H2,1H3/b5-2-,14-8-,20-11+/t22?,28-/m0/s1 |
| InChIKey | KDVKHKUZSXLGPE-REFJQRAFSA-N |
| XLogP | 5.51 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |