C23H31N5O3S — CID 173472466
methyl 1-[[[3-amino-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimino-4-oxopent-2-en-2-yl]amino]carbamothioyl]piperidine-4-carboxylate (PubChem CID 173472466) has the molecular formula C23H31N5O3S and a molecular weight of 457.60 g/mol. Its IUPAC name is methyl 1-[[[3-amino-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimino-4-oxopent-2-en-2-yl]amino]carbamothioyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[[3-amino-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimino-4-oxopent-2-en-2-yl]amino]carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 173472466 |
| Molecular Formula | C23H31N5O3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | methyl 1-[[[3-amino-5-(2,3-dihydro-1H-inden-5-yl)-5-methylimino-4-oxopent-2-en-2-yl]amino]carbamothioyl]piperidine-4-carboxylate |
| SMILES | C/N=C(/C(=O)C(N)=C(C)NNC(=S)N1CCC(C(=O)OC)CC1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H31N5O3S/c1-14(26-27-23(32)28-11-9-16(10-12-28)22(30)31-3)19(24)21(29)20(25-2)18-8-7-15-5-4-6-17(15)13-18/h7-8,13,16,26H,4-6,9-12,24H2,1-3H3,(H,27,32)/b19-14?,25-20+ |
| InChIKey | DHCLMPXIAMXJLP-ZZHKEVELSA-N |
| XLogP | 1.62 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|