About 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene
1-[(1E)-buta-1,3-dienyl]-2-propylbenzene (PubChem CID 173472547) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene.
Molecular Properties
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene |
| PubChem CID | 173472547 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene |
| SMILES | C=C/C=C/c1ccccc1CCC |
| InChI | InChI=1S/C13H16/c1-3-5-9-13-11-7-6-10-12(13)8-4-2/h3,5-7,9-11H,1,4,8H2,2H3/b9-5+ |
| InChIKey | VDOOGWLJDGMHBM-WEVVVXLNSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene?
The IUPAC name of 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene (CID 173472547) is 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene.
What is the SMILES notation for 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene?
The canonical SMILES for 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene is C=C/C=C/c1ccccc1CCC.
What is the InChIKey of 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene?
The InChIKey is VDOOGWLJDGMHBM-WEVVVXLNSA-N. The full InChI is InChI=1S/C13H16/c1-3-5-9-13-11-7-6-10-12(13)8-4-2/h3,5-7,9-11H,1,4,8H2,2H3/b9-5+.
What are the key properties of 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene?
1-[(1E)-buta-1,3-dienyl]-2-propylbenzene has a molecular weight of 172.27 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-buta-1,3-dienyl]-2-propylbenzene is sourced from PubChem (CID 173472547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).