C87H100Si — CID 173473425
tris[3,5-bis[(2,4,6-trimethylphenyl)methyl]phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173473425) has the molecular formula C87H100Si and a molecular weight of 1173.84 g/mol. Its IUPAC name is tris[3,5-bis[(2,4,6-trimethylphenyl)methyl]phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris[3,5-bis[(2,4,6-trimethylphenyl)methyl]phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473425 |
| Molecular Formula | C87H100Si |
| Molecular Weight | 1173.84 g/mol |
| Exact Mass | 1172.76 |
| IUPAC Name | tris[3,5-bis[(2,4,6-trimethylphenyl)methyl]phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2cc(Cc3c(C)cc(C)cc3C)cc(Cc3c(C)cc(C)cc3C)c2)(c2cc(Cc3c(C)cc(C)cc3C)cc(Cc3c(C)cc(C)cc3C)c2)c2cc(Cc3c(C)cc(C)cc3C)cc(Cc3c(C)cc(C)cc3C)c2)C(C)=C1C |
| InChI | InChI=1S/C87H100Si/c1-51-23-57(7)81(58(8)24-51)44-72-35-73(45-82-59(9)25-52(2)26-60(82)10)39-78(38-72)88(87(22)50-69(19)70(20)71(87)21,79-40-74(46-83-61(11)27-53(3)28-62(83)12)36-75(41-79)47-84-63(13)29-54(4)30-64(84)14)80-42-76(48-85-65(15)31-55(5)32-66(85)16)37-77(43-80)49-86-67(17)33-56(6)34-68(86)18/h23-43,50H,44-49H2,1-22H3 |
| InChIKey | IZIARKVKVBGHSO-UHFFFAOYSA-N |
| XLogP | 20.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.84 |
| LogP ≤ 5 | 20.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|