C42H56Si — CID 173473434
(3,5-ditert-butylphenyl)-(3,5-diethylphenyl)-(3,5-dimethylphenyl)-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane (PubChem CID 173473434) has the molecular formula C42H56Si and a molecular weight of 589.00 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)-(3,5-diethylphenyl)-(3,5-dimethylphenyl)-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane.
| Compound Name | (3,5-ditert-butylphenyl)-(3,5-diethylphenyl)-(3,5-dimethylphenyl)-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 173473434 |
| Molecular Formula | C42H56Si |
| Molecular Weight | 589.00 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | (3,5-ditert-butylphenyl)-(3,5-diethylphenyl)-(3,5-dimethylphenyl)-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
| SMILES | CCc1cc(CC)cc([Si](c2cc(C)cc(C)c2)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2C(C)CC3C=CC=CC32)c1 |
| InChI | InChI=1S/C42H56Si/c1-12-31-22-32(13-2)24-37(23-31)43(36-19-28(3)18-29(4)20-36,40-30(5)21-33-16-14-15-17-39(33)40)38-26-34(41(6,7)8)25-35(27-38)42(9,10)11/h14-20,22-27,30,33,39-40H,12-13,21H2,1-11H3 |
| InChIKey | DSNGVMPIKBBAHU-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.00 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|