C31H35SiTi- — CID 173474242
(3,5-dimethylphenyl)-bis(3-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium (PubChem CID 173474242) has the molecular formula C31H35SiTi- and a molecular weight of 483.57 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-bis(3-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium.
| Compound Name | (3,5-dimethylphenyl)-bis(3-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium |
|---|---|
| PubChem CID | 173474242 |
| Molecular Formula | C31H35SiTi- |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (3,5-dimethylphenyl)-bis(3-methylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium |
| SMILES | CC1=[C-]C(C)([Si](c2cccc(C)c2)(c2cccc(C)c2)c2cc(C)cc(C)c2)C(C)=C1C.[Ti] |
| InChI | InChI=1S/C31H35Si.Ti/c1-21-11-9-13-28(16-21)32(29-14-10-12-22(2)17-29,30-18-23(3)15-24(4)19-30)31(8)20-25(5)26(6)27(31)7;/h9-19H,1-8H3;/q-1; |
| InChIKey | SVEAOMKZXCWVON-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|