About [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane
[2-(2,2-dimethylpropyl)phenyl]-trimethylsilane (PubChem CID 173474288) has the molecular formula C14H24Si
and a molecular weight of 220.43 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane |
|---|
| PubChem CID | 173474288 |
|---|
| Molecular Formula | C14H24Si |
|---|
| Molecular Weight | 220.43 g/mol |
|---|
| Exact Mass | 220.16 |
|---|
| IUPAC Name | [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane |
|---|
| SMILES | CC(C)(C)Cc1ccccc1[Si](C)(C)C |
|---|
| InChI | InChI=1S/C14H24Si/c1-14(2,3)11-12-9-7-8-10-13(12)15(4,5)6/h7-10H,11H2,1-6H3 |
|---|
| InChIKey | WRFOPMJLFDCXCP-UHFFFAOYSA-N |
|---|
| XLogP | 3.82 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 15 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane?
The IUPAC name of [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane (CID 173474288) is [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane.
What is the SMILES notation for [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane?
The canonical SMILES for [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane is CC(C)(C)Cc1ccccc1[Si](C)(C)C.
What is the InChIKey of [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane?
The InChIKey is WRFOPMJLFDCXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24Si/c1-14(2,3)11-12-9-7-8-10-13(12)15(4,5)6/h7-10H,11H2,1-6H3.
What are the key properties of [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane?
[2-(2,2-dimethylpropyl)phenyl]-trimethylsilane has a molecular weight of 220.43 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-dimethylpropyl)phenyl]-trimethylsilane is sourced from PubChem (CID 173474288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).