C51H88Si7 — CID 173474429
tris[2,5-dimethyl-3,6-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173474429) has the molecular formula C51H88Si7 and a molecular weight of 897.87 g/mol. Its IUPAC name is tris[2,5-dimethyl-3,6-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris[2,5-dimethyl-3,6-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173474429 |
| Molecular Formula | C51H88Si7 |
| Molecular Weight | 897.87 g/mol |
| Exact Mass | 896.53 |
| IUPAC Name | tris[2,5-dimethyl-3,6-bis(trimethylsilyl)phenyl]-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)([Si](c2c(C)c([Si](C)(C)C)cc(C)c2[Si](C)(C)C)(c2c(C)c([Si](C)(C)C)cc(C)c2[Si](C)(C)C)c2c(C)c([Si](C)(C)C)cc(C)c2[Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C51H88Si7/c1-33-29-42(52(11,12)13)38(6)48(45(33)55(20,21)22)58(51(10)32-36(4)37(5)41(51)9,49-39(7)43(53(14,15)16)30-34(2)46(49)56(23,24)25)50-40(8)44(54(17,18)19)31-35(3)47(50)57(26,27)28/h29-32H,1-28H3 |
| InChIKey | CNPIGECEZNCCIO-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.87 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|