About platinum;prop-1-ene;silyloxysilane
platinum;prop-1-ene;silyloxysilane (PubChem CID 173474461) has the molecular formula C3H11OPtSi2-
and a molecular weight of 314.37 g/mol. Its IUPAC name is platinum;prop-1-ene;silyloxysilane.
Molecular Properties
| Compound Name | platinum;prop-1-ene;silyloxysilane |
| PubChem CID | 173474461 |
| Molecular Formula | C3H11OPtSi2- |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | platinum;prop-1-ene;silyloxysilane |
| SMILES | C=C[CH2-].[Pt].[SiH3]O[SiH3] |
| InChI | InChI=1S/C3H5.H6OSi2.Pt/c1-3-2;2-1-3;/h3H,1-2H2;2-3H3;/q-1;; |
| InChIKey | PKXZGAGSPSFOGA-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze platinum;prop-1-ene;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;prop-1-ene;silyloxysilane?
The IUPAC name of platinum;prop-1-ene;silyloxysilane (CID 173474461) is platinum;prop-1-ene;silyloxysilane.
What is the SMILES notation for platinum;prop-1-ene;silyloxysilane?
The canonical SMILES for platinum;prop-1-ene;silyloxysilane is C=C[CH2-].[Pt].[SiH3]O[SiH3].
What is the InChIKey of platinum;prop-1-ene;silyloxysilane?
The InChIKey is PKXZGAGSPSFOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5.H6OSi2.Pt/c1-3-2;2-1-3;/h3H,1-2H2;2-3H3;/q-1;;.
What are the key properties of platinum;prop-1-ene;silyloxysilane?
platinum;prop-1-ene;silyloxysilane has a molecular weight of 314.37 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;prop-1-ene;silyloxysilane is sourced from PubChem (CID 173474461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).