About [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate
[2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate (PubChem CID 173475197) has the molecular formula C14H14F3N5O6
and a molecular weight of 405.29 g/mol. Its IUPAC name is [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate.
Molecular Properties
| Compound Name | [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate |
| PubChem CID | 173475197 |
| Molecular Formula | C14H14F3N5O6 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate |
| SMILES | [H]/N=C(\C=C(\C)NC(=O)NCC)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N5O6/c1-3-19-13(23)20-7(2)4-11(18)28-12-9(14(15,16)17)5-8(21(24)25)6-10(12)22(26)27/h4-6,18H,3H2,1-2H3,(H2,19,20,23)/b7-4-,18-11+ |
| InChIKey | KIWIESKXNZZBLY-GBEFZSMMSA-N |
| XLogP | 3.10 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate?
The IUPAC name of [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate (CID 173475197) is [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate.
What is the SMILES notation for [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate?
The canonical SMILES for [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate is [H]/N=C(\C=C(\C)NC(=O)NCC)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F.
What is the InChIKey of [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate?
The InChIKey is KIWIESKXNZZBLY-GBEFZSMMSA-N. The full InChI is InChI=1S/C14H14F3N5O6/c1-3-19-13(23)20-7(2)4-11(18)28-12-9(14(15,16)17)5-8(21(24)25)6-10(12)22(26)27/h4-6,18H,3H2,1-2H3,(H2,19,20,23)/b7-4-,18-11+.
What are the key properties of [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate?
[2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate has a molecular weight of 405.29 g/mol, XLogP of 3.10, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dinitro-6-(trifluoromethyl)phenyl] (Z)-3-(ethylcarbamoylamino)but-2-enimidate is sourced from PubChem (CID 173475197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).