C19H28N4O2 — CID 173475628
3-amino-2-[N-[(3S,7R)-5-hydroxy-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-C-(1H-pyrrol-2-yl)carbonimidoyl]prop-2-enamide (PubChem CID 173475628) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-amino-2-[N-[(3S,7R)-5-hydroxy-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-C-(1H-pyrrol-2-yl)carbonimidoyl]prop-2-enamide.
| Compound Name | 3-amino-2-[N-[(3S,7R)-5-hydroxy-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-C-(1H-pyrrol-2-yl)carbonimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 173475628 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-amino-2-[N-[(3S,7R)-5-hydroxy-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-C-(1H-pyrrol-2-yl)carbonimidoyl]prop-2-enamide |
| SMILES | C[C@@H]1CC2(O)C[C@H](C)CC(/N=C(/C(=CN)C(N)=O)c3ccc[nH]3)(C1)C2 |
| InChI | InChI=1S/C19H28N4O2/c1-12-6-18(7-13(2)9-19(25,8-12)11-18)23-16(14(10-20)17(21)24)15-4-3-5-22-15/h3-5,10,12-13,22,25H,6-9,11,20H2,1-2H3,(H2,21,24)/b14-10?,23-16-/t12-,13+,18?,19? |
| InChIKey | LGYNFFDKIASVSE-YIHXQRQWSA-N |
| XLogP | 1.85 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|