C17H15ClF5N3S2 — CID 173475639
N'-[(E)-(4-chloro-2-methylidenethiophen-3-ylidene)-[1-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]ethylamino]methyl]methanimidamide (PubChem CID 173475639) has the molecular formula C17H15ClF5N3S2 and a molecular weight of 455.91 g/mol. Its IUPAC name is N'-[(E)-(4-chloro-2-methylidenethiophen-3-ylidene)-[1-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]ethylamino]methyl]methanimidamide.
| Compound Name | N'-[(E)-(4-chloro-2-methylidenethiophen-3-ylidene)-[1-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]ethylamino]methyl]methanimidamide |
|---|---|
| PubChem CID | 173475639 |
| Molecular Formula | C17H15ClF5N3S2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N'-[(E)-(4-chloro-2-methylidenethiophen-3-ylidene)-[1-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]ethylamino]methyl]methanimidamide |
| SMILES | C=c1scc(Cl)/c1=C(/N=CN)NC(C)c1ccc(SC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15ClF5N3S2/c1-9(26-15(25-8-24)14-10(2)27-7-13(14)18)11-3-5-12(6-4-11)28-17(22,23)16(19,20)21/h3-9,26H,2H2,1H3,(H2,24,25)/b15-14- |
| InChIKey | XLHZUPMXWXCPMF-PFONDFGASA-N |
| XLogP | 4.46 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|