C21H35N3O3S2 — CID 173475672
[[(1R)-1-[(1S,5R)-8-(2-aminoethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-2-phenylethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 173475672) has the molecular formula C21H35N3O3S2 and a molecular weight of 441.66 g/mol. Its IUPAC name is [[(1R)-1-[(1S,5R)-8-(2-aminoethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-2-phenylethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1R)-1-[(1S,5R)-8-(2-aminoethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-2-phenylethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 173475672 |
| Molecular Formula | C21H35N3O3S2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [[(1R)-1-[(1S,5R)-8-(2-aminoethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-yl]-2-phenylethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](Cc1ccccc1)C1C[C@H]2CC[C@@H](C1)N2S(=O)(=O)CCN |
| InChI | InChI=1S/C21H35N3O3S2/c1-21(2,3)28(25)23-20(13-16-7-5-4-6-8-16)17-14-18-9-10-19(15-17)24(18)29(26,27)12-11-22/h4-8,17-20,23H,9-15,22H2,1-3H3/t17?,18-,19+,20-,28?/m1/s1 |
| InChIKey | LETXWSIPQKAHIX-WVGQWFNWSA-N |
| XLogP | 2.18 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|