C19H21ClN4O — CID 173476201
[5-(2-chloroethylideneamino)-1-ethenylpyrazol-3-yl]-(1,4-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 173476201) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is [5-(2-chloroethylideneamino)-1-ethenylpyrazol-3-yl]-(1,4-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [5-(2-chloroethylideneamino)-1-ethenylpyrazol-3-yl]-(1,4-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 173476201 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [5-(2-chloroethylideneamino)-1-ethenylpyrazol-3-yl]-(1,4-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | C=Cn1nc(C(=O)N2CC(C)c3ccccc3C2C)cc1N=CCCl |
| InChI | InChI=1S/C19H21ClN4O/c1-4-24-18(21-10-9-20)11-17(22-24)19(25)23-12-13(2)15-7-5-6-8-16(15)14(23)3/h4-8,10-11,13-14H,1,9,12H2,2-3H3 |
| InChIKey | KXIOZIWJPXNIHH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|