C23H34O6 — CID 173476371
ethyl 4-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-hydroxy-2-oxobut-3-enoate (PubChem CID 173476371) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is ethyl 4-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | ethyl 4-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 173476371 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | ethyl 4-(2,4-dibutoxy-5-propan-2-ylphenyl)-4-hydroxy-2-oxobut-3-enoate |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1C(O)=CC(=O)C(=O)OCC |
| InChI | InChI=1S/C23H34O6/c1-6-9-11-28-21-15-22(29-12-10-7-2)18(13-17(21)16(4)5)19(24)14-20(25)23(26)27-8-3/h13-16,24H,6-12H2,1-5H3 |
| InChIKey | WBOKAXGWYKFCKZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|