C21H16BN3O4 — CID 173476418
CID 173476418 (PubChem CID 173476418) has the molecular formula C21H16BN3O4 and a molecular weight of 385.19 g/mol.
| Compound Name | CID 173476418 |
|---|---|
| PubChem CID | 173476418 |
| Molecular Formula | C21H16BN3O4 |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2oc(C=C3C=Nc4ncccc43)c(O)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C21H16BN3O4/c1-2-28-21(27)17-18(26)16(10-12-11-24-19-15(12)4-3-9-23-19)29-20(17)25-14-7-5-13(22)6-8-14/h3-11,25-26H,2H2,1H3 |
| InChIKey | YUVATTOJXDDCDL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|