C21H23N3O4 — CID 173476432
4-(1-ethoxyethenyl)-5-(1,4-oxazepan-4-yl)-2-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)furan-3-ol (PubChem CID 173476432) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)-5-(1,4-oxazepan-4-yl)-2-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)furan-3-ol.
| Compound Name | 4-(1-ethoxyethenyl)-5-(1,4-oxazepan-4-yl)-2-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)furan-3-ol |
|---|---|
| PubChem CID | 173476432 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-(1-ethoxyethenyl)-5-(1,4-oxazepan-4-yl)-2-(pyrrolo[2,3-b]pyridin-3-ylidenemethyl)furan-3-ol |
| SMILES | C=C(OCC)c1c(N2CCCOCC2)oc(C=C2C=Nc3ncccc32)c1O |
| InChI | InChI=1S/C21H23N3O4/c1-3-27-14(2)18-19(25)17(28-21(18)24-8-5-10-26-11-9-24)12-15-13-23-20-16(15)6-4-7-22-20/h4,6-7,12-13,25H,2-3,5,8-11H2,1H3 |
| InChIKey | XZZVICSESGDSSV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|