C28H33ClFIN6O4S — CID 173476895
tert-butyl (3S)-3-[[(E)-1-[[amino-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]methylidene]amino]-2-fluoro-3-iodoprop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 173476895) has the molecular formula C28H33ClFIN6O4S and a molecular weight of 731.03 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(E)-1-[[amino-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]methylidene]amino]-2-fluoro-3-iodoprop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(E)-1-[[amino-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]methylidene]amino]-2-fluoro-3-iodoprop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 173476895 |
| Molecular Formula | C28H33ClFIN6O4S |
| Molecular Weight | 731.03 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | tert-butyl (3S)-3-[[(E)-1-[[amino-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]methylidene]amino]-2-fluoro-3-iodoprop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(N)=N/C(N[C@H]3CCCN(C(=O)OC(C)(C)C)C3)=C(/F)CI)c3cc(Cl)cnc32)cc1 |
| InChI | InChI=1S/C28H33ClFIN6O4S/c1-17-7-9-20(10-8-17)42(39,40)37-16-22(21-12-18(29)14-33-26(21)37)24(32)35-25(23(30)13-31)34-19-6-5-11-36(15-19)27(38)41-28(2,3)4/h7-10,12,14,16,19,34H,5-6,11,13,15H2,1-4H3,(H2,32,35)/b25-23+/t19-/m0/s1 |
| InChIKey | ODRVZLNGWVQOQC-UOVSXWEZSA-N |
| XLogP | 5.50 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|