About (1R)-1-chloroethane-1,2-diol
(1R)-1-chloroethane-1,2-diol (PubChem CID 173477166) has the molecular formula C2H5ClO2
and a molecular weight of 96.51 g/mol. Its IUPAC name is (1R)-1-chloroethane-1,2-diol.
Molecular Properties
| Compound Name | (1R)-1-chloroethane-1,2-diol |
| PubChem CID | 173477166 |
| Molecular Formula | C2H5ClO2 |
| Molecular Weight | 96.51 g/mol |
| Exact Mass | 96.00 |
| IUPAC Name | (1R)-1-chloroethane-1,2-diol |
| SMILES | OC[C@H](O)Cl |
| InChI | InChI=1S/C2H5ClO2/c3-2(5)1-4/h2,4-5H,1H2/t2-/m0/s1 |
| InChIKey | VVKFXODVPQSIHU-REOHCLBHSA-N |
| XLogP | -0.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.51 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-chloroethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-chloroethane-1,2-diol?
The IUPAC name of (1R)-1-chloroethane-1,2-diol (CID 173477166) is (1R)-1-chloroethane-1,2-diol.
What is the SMILES notation for (1R)-1-chloroethane-1,2-diol?
The canonical SMILES for (1R)-1-chloroethane-1,2-diol is OC[C@H](O)Cl.
What is the InChIKey of (1R)-1-chloroethane-1,2-diol?
The InChIKey is VVKFXODVPQSIHU-REOHCLBHSA-N. The full InChI is InChI=1S/C2H5ClO2/c3-2(5)1-4/h2,4-5H,1H2/t2-/m0/s1.
What are the key properties of (1R)-1-chloroethane-1,2-diol?
(1R)-1-chloroethane-1,2-diol has a molecular weight of 96.51 g/mol, XLogP of -0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-chloroethane-1,2-diol is sourced from PubChem (CID 173477166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).