About CID 173477493
CID 173477493 (PubChem CID 173477493) has the molecular formula C18H19BFN3O4S
and a molecular weight of 403.24 g/mol.
Molecular Properties
| Compound Name | CID 173477493 |
| PubChem CID | 173477493 |
| Molecular Formula | C18H19BFN3O4S |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | — |
| SMILES | [B]c1nc(-c2cncc(F)c2)sc1N(C(=O)O/C(C)=C/C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H19BFN3O4S/c1-6-10(2)26-16(24)23(17(25)27-18(3,4)5)15-13(19)22-14(28-15)11-7-12(20)9-21-8-11/h6-9H,1-5H3/b10-6+ |
| InChIKey | IONRXAISZGHXPS-UXBLZVDNSA-N |
| XLogP | 3.94 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173477493 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173477493?
The IUPAC name of CID 173477493 (CID 173477493) is not available.
What is the SMILES notation for CID 173477493?
The canonical SMILES for CID 173477493 is [B]c1nc(-c2cncc(F)c2)sc1N(C(=O)O/C(C)=C/C)C(=O)OC(C)(C)C.
What is the InChIKey of CID 173477493?
The InChIKey is IONRXAISZGHXPS-UXBLZVDNSA-N. The full InChI is InChI=1S/C18H19BFN3O4S/c1-6-10(2)26-16(24)23(17(25)27-18(3,4)5)15-13(19)22-14(28-15)11-7-12(20)9-21-8-11/h6-9H,1-5H3/b10-6+.
What are the key properties of CID 173477493?
CID 173477493 has a molecular weight of 403.24 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173477493 is sourced from PubChem (CID 173477493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).