About 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide
2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide (PubChem CID 173477624) has the molecular formula C5H12N6
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide |
| PubChem CID | 173477624 |
| Molecular Formula | C5H12N6 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide |
| SMILES | C=C(N)N=C(N)C(N)=C(N)N |
| InChI | InChI=1S/C5H12N6/c1-2(6)11-5(10)3(7)4(8)9/h1,6-9H2,(H2,10,11) |
| InChIKey | AMTTZHHHLBZAQT-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide?
The IUPAC name of 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide (CID 173477624) is 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide.
What is the SMILES notation for 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide?
The canonical SMILES for 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide is C=C(N)N=C(N)C(N)=C(N)N.
What is the InChIKey of 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide?
The InChIKey is AMTTZHHHLBZAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N6/c1-2(6)11-5(10)3(7)4(8)9/h1,6-9H2,(H2,10,11).
What are the key properties of 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide?
2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide has a molecular weight of 156.19 g/mol, XLogP of -2.18, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-triamino-N'-(1-aminoethenyl)prop-2-enimidamide is sourced from PubChem (CID 173477624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).