About (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one
(8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one (PubChem CID 173477629) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one.
Molecular Properties
| Compound Name | (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one |
| PubChem CID | 173477629 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one |
| SMILES | C/C1=N/C=C\CC(=O)N(C)C=C1 |
| InChI | InChI=1S/C9H12N2O/c1-8-5-7-11(2)9(12)4-3-6-10-8/h3,5-7H,4H2,1-2H3/b6-3-,7-5?,10-8- |
| InChIKey | FLBSAAVGMSSDDE-HTGOHIATSA-N |
| XLogP | 1.34 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one?
The IUPAC name of (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one (CID 173477629) is (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one.
What is the SMILES notation for (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one?
The canonical SMILES for (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one is C/C1=N/C=C\CC(=O)N(C)C=C1.
What is the InChIKey of (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one?
The InChIKey is FLBSAAVGMSSDDE-HTGOHIATSA-N. The full InChI is InChI=1S/C9H12N2O/c1-8-5-7-11(2)9(12)4-3-6-10-8/h3,5-7H,4H2,1-2H3/b6-3-,7-5?,10-8-.
What are the key properties of (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one?
(8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one has a molecular weight of 164.21 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z)-2,5-dimethyl-7H-1,5-diazonin-6-one is sourced from PubChem (CID 173477629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).