C36H42N3O10S2+ — CID 173478148
1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[5-(1-ethyl-3-methyl-5-sulfo-3H-indol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid (PubChem CID 173478148) has the molecular formula C36H42N3O10S2+ and a molecular weight of 740.88 g/mol. Its IUPAC name is 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[5-(1-ethyl-3-methyl-5-sulfo-3H-indol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[5-(1-ethyl-3-methyl-5-sulfo-3H-indol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 173478148 |
| Molecular Formula | C36H42N3O10S2+ |
| Molecular Weight | 740.88 g/mol |
| Exact Mass | 740.23 |
| IUPAC Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[5-(1-ethyl-3-methyl-5-sulfo-3H-indol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)ON3C(=O)CCC3=O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C36H41N3O10S2/c1-5-37-29(24(2)27-22-25(50(43,44)45)15-17-30(27)37)12-8-6-9-13-32-36(3,4)28-23-26(51(46,47)48)16-18-31(28)38(32)21-11-7-10-14-35(42)49-39-33(40)19-20-34(39)41/h6,8-9,12-13,15-18,22-24H,5,7,10-11,14,19-21H2,1-4H3,(H-,43,44,45,46,47,48)/p+1 |
| InChIKey | GQAQBWJRIBOFKI-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|