About (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine
(E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine (PubChem CID 173478274) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine |
| PubChem CID | 173478274 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine |
| SMILES | C=C(N=C/C(N)=C\N)OCC |
| InChI | InChI=1S/C7H13N3O/c1-3-11-6(2)10-5-7(9)4-8/h4-5H,2-3,8-9H2,1H3/b7-4+,10-5? |
| InChIKey | LPURCRPOCBOOBS-BXHZIHGASA-N |
| XLogP | 0.32 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine?
The IUPAC name of (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine (CID 173478274) is (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine.
What is the SMILES notation for (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine?
The canonical SMILES for (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine is C=C(N=C/C(N)=C\N)OCC.
What is the InChIKey of (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine?
The InChIKey is LPURCRPOCBOOBS-BXHZIHGASA-N. The full InChI is InChI=1S/C7H13N3O/c1-3-11-6(2)10-5-7(9)4-8/h4-5H,2-3,8-9H2,1H3/b7-4+,10-5?.
What are the key properties of (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine?
(E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine has a molecular weight of 155.20 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-ethoxyethenylimino)prop-1-ene-1,2-diamine is sourced from PubChem (CID 173478274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).