C18H23N5OS2 — CID 173478392
4,6-bis(sulfanylidene)-5-[(2Z)-2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-2-one (PubChem CID 173478392) has the molecular formula C18H23N5OS2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 4,6-bis(sulfanylidene)-5-[(2Z)-2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-2-one.
| Compound Name | 4,6-bis(sulfanylidene)-5-[(2Z)-2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 173478392 |
| Molecular Formula | C18H23N5OS2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4,6-bis(sulfanylidene)-5-[(2Z)-2-(1,3,4-triethyl-5-methylpyrrolo[2,3-d]imidazol-2-ylidene)ethylidene]-1,3-diazinan-2-one |
| SMILES | CCN1/C(=C/C=C2C(=S)NC(=O)NC2=S)N(CC)c2c1cc(C)n2CC |
| InChI | InChI=1S/C18H23N5OS2/c1-5-21-11(4)10-13-17(21)23(7-3)14(22(13)6-2)9-8-12-15(25)19-18(24)20-16(12)26/h8-10H,5-7H2,1-4H3,(H2,19,20,24,25,26)/b14-9- |
| InChIKey | YOOAWPCBWYSRTG-ZROIWOOFSA-N |
| XLogP | 3.22 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|