C19H18F3N5O3S — CID 173478775
2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1S)-2,2,2-trifluoro-1-phenylethyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide (PubChem CID 173478775) has the molecular formula C19H18F3N5O3S and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1S)-2,2,2-trifluoro-1-phenylethyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1S)-2,2,2-trifluoro-1-phenylethyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 173478775 |
| Molecular Formula | C19H18F3N5O3S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[1-oxido-4-[(1S)-2,2,2-trifluoro-1-phenylethyl]imino-1,2,5-thiadiazol-1-ium-3-yl]amino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2n[s+]([O-])[nH]/c2=N\[C@@H](c2ccccc2)C(F)(F)F)c1O |
| InChI | InChI=1S/C19H18F3N5O3S/c1-27(2)18(29)12-9-6-10-13(14(12)28)23-16-17(26-31(30)25-16)24-15(19(20,21)22)11-7-4-3-5-8-11/h3-10,15,28H,1-2H3,(H,23,25)(H,24,26)/t15-,31?/m0/s1 |
| InChIKey | LFOHIGCUPOELIK-NENZQZOMSA-N |
| XLogP | 3.49 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|