C17H17N5O3S — CID 173479429
2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzonitrile (PubChem CID 173479429) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzonitrile.
| Compound Name | 2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 173479429 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-hydroxy-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]benzonitrile |
| SMILES | CC[C@@H](/N=c1\[nH][s+]([O-])nc1Nc1cccc(C#N)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C17H17N5O3S/c1-3-12(14-8-7-10(2)25-14)19-16-17(22-26(24)21-16)20-13-6-4-5-11(9-18)15(13)23/h4-8,12,23H,3H2,1-2H3,(H,19,21)(H,20,22)/t12-,26?/m1/s1 |
| InChIKey | LIMKNCZOMRLEGN-ISZNTPMXSA-N |
| XLogP | 3.41 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|