C7H9Cl2N — CID 173480045
N-[(1E,3Z)-1-chloropenta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 173480045) has the molecular formula C7H9Cl2N and a molecular weight of 178.06 g/mol. Its IUPAC name is N-[(1E,3Z)-1-chloropenta-1,3-dienyl]ethanimidoyl chloride.
| Compound Name | N-[(1E,3Z)-1-chloropenta-1,3-dienyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 173480045 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | N-[(1E,3Z)-1-chloropenta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | C/C=C\C=C(\Cl)N=C(C)Cl |
| InChI | InChI=1S/C7H9Cl2N/c1-3-4-5-7(9)10-6(2)8/h3-5H,1-2H3/b4-3-,7-5-,10-6? |
| InChIKey | CODINAFXSONVLY-GESCJDIXSA-N |
| XLogP | 3.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|