C19H18N4O3S2 — CID 173480067
N'-[5-[[5-[(Z)-but-2-en-2-yl]-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]-N-phenyloxamide (PubChem CID 173480067) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N'-[5-[[5-[(Z)-but-2-en-2-yl]-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]-N-phenyloxamide.
| Compound Name | N'-[5-[[5-[(Z)-but-2-en-2-yl]-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]-N-phenyloxamide |
|---|---|
| PubChem CID | 173480067 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N'-[5-[[5-[(Z)-but-2-en-2-yl]-1,3-oxazol-2-yl]methylsulfanyl]-1,3-thiazol-2-yl]-N-phenyloxamide |
| SMILES | C/C=C(/C)c1cnc(CSc2cnc(NC(=O)C(=O)Nc3ccccc3)s2)o1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-3-12(2)14-9-20-15(26-14)11-27-16-10-21-19(28-16)23-18(25)17(24)22-13-7-5-4-6-8-13/h3-10H,11H2,1-2H3,(H,22,24)(H,21,23,25)/b12-3- |
| InChIKey | PDBOSOOVYUWPSG-BASWHVEKSA-N |
| XLogP | 4.42 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|