C20H44ClNS — CID 173480260
11-amino-10,11-dipropyltetradecane-1-thiol;hydrochloride (PubChem CID 173480260) has the molecular formula C20H44ClNS and a molecular weight of 366.10 g/mol. Its IUPAC name is 11-amino-10,11-dipropyltetradecane-1-thiol;hydrochloride.
| Compound Name | 11-amino-10,11-dipropyltetradecane-1-thiol;hydrochloride |
|---|---|
| PubChem CID | 173480260 |
| Molecular Formula | C20H44ClNS |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | 11-amino-10,11-dipropyltetradecane-1-thiol;hydrochloride |
| SMILES | CCCC(CCCCCCCCCS)C(N)(CCC)CCC.Cl |
| InChI | InChI=1S/C20H43NS.ClH/c1-4-14-19(20(21,16-5-2)17-6-3)15-12-10-8-7-9-11-13-18-22;/h19,22H,4-18,21H2,1-3H3;1H |
| InChIKey | PIJATJWFFAHMFR-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|